Palladium PCP pincer complex (Q115620070)
Jump to navigation
Jump to search
chemical compound
- (SP-4-3)-[1,3-bis[(dicyclohexylphosphino-κP)methyl]tricyclo[3.3.1.13,7]dec-2-yl-κC]chloropalladium
| Language | Label | Description | Also known as |
|---|---|---|---|
| English | Palladium PCP pincer complex |
chemical compound |
|
Statements
[Cl-][Pd+2]12[CH-]3C4(CC5CC(C4)CC3(C5)C[P]1(C6CCCCC6)C7CCCCC7)C[P]2(C8CCCCC8)C9CCCCC9
0 references
Palladium PCP pincer complex
0 references
Identifiers
Sitelinks
Wikipedia(0 entries)
Wikibooks(0 entries)
Wikinews(0 entries)
Wikiquote(0 entries)
Wikisource(0 entries)
Wikiversity(0 entries)
Wikivoyage(0 entries)
Wiktionary(0 entries)
Multilingual sites(1 entry)
- commonswiki Category:Palladium PCP pincer complex